C17H11N3O4S — CID 168589613
[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl] furan-2-carboxylate (PubChem CID 168589613) has the molecular formula C17H11N3O4S and a molecular weight of 353.36 g/mol. Its IUPAC name is [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl] furan-2-carboxylate.
| Compound Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 168589613 |
| Molecular Formula | C17H11N3O4S |
| Molecular Weight | 353.36 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | [3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenyl] furan-2-carboxylate |
| SMILES | CSc1nc(-c2cccc(OC(=O)c3ccco3)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C17H11N3O4S/c1-25-17-19-14(12(9-18)15(21)20-17)10-4-2-5-11(8-10)24-16(22)13-6-3-7-23-13/h2-8H,1H3,(H,19,20,21) |
| InChIKey | YEZONTKDRCCVHF-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.36 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|