C14H12BrN3O2S — CID 168588743
4-[3-(2-bromoethoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile (PubChem CID 168588743) has the molecular formula C14H12BrN3O2S and a molecular weight of 366.24 g/mol. Its IUPAC name is 4-[3-(2-bromoethoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile.
| Compound Name | 4-[3-(2-bromoethoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588743 |
| Molecular Formula | C14H12BrN3O2S |
| Molecular Weight | 366.24 g/mol |
| Exact Mass | 364.98 |
| IUPAC Name | 4-[3-(2-bromoethoxy)phenyl]-2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cccc(OCCBr)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C14H12BrN3O2S/c1-21-14-17-12(11(8-16)13(19)18-14)9-3-2-4-10(7-9)20-6-5-15/h2-4,7H,5-6H2,1H3,(H,17,18,19) |
| InChIKey | XLDLNNNSDHXMMT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.24 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|