C15H11N5OS — CID 168588660
2-methylsulfanyl-6-oxo-4-[3-(1H-pyrazol-4-yl)phenyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168588660) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-methylsulfanyl-6-oxo-4-[3-(1H-pyrazol-4-yl)phenyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-6-oxo-4-[3-(1H-pyrazol-4-yl)phenyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168588660 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-methylsulfanyl-6-oxo-4-[3-(1H-pyrazol-4-yl)phenyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cccc(-c3cn[nH]c3)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C15H11N5OS/c1-22-15-19-13(12(6-16)14(21)20-15)10-4-2-3-9(5-10)11-7-17-18-8-11/h2-5,7-8H,1H3,(H,17,18)(H,19,20,21) |
| InChIKey | LJBHMIUMTMJOET-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|