C13H9N7OS — CID 168589511
2-methylsulfanyl-6-oxo-4-[3-(2H-tetrazol-5-yl)phenyl]-1H-pyrimidine-5-carbonitrile (PubChem CID 168589511) has the molecular formula C13H9N7OS and a molecular weight of 311.33 g/mol. Its IUPAC name is 2-methylsulfanyl-6-oxo-4-[3-(2H-tetrazol-5-yl)phenyl]-1H-pyrimidine-5-carbonitrile.
| Compound Name | 2-methylsulfanyl-6-oxo-4-[3-(2H-tetrazol-5-yl)phenyl]-1H-pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 168589511 |
| Molecular Formula | C13H9N7OS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-methylsulfanyl-6-oxo-4-[3-(2H-tetrazol-5-yl)phenyl]-1H-pyrimidine-5-carbonitrile |
| SMILES | CSc1nc(-c2cccc(-c3nn[nH]n3)c2)c(C#N)c(=O)[nH]1 |
| InChI | InChI=1S/C13H9N7OS/c1-22-13-15-10(9(6-14)12(21)16-13)7-3-2-4-8(5-7)11-17-19-20-18-11/h2-5H,1H3,(H,15,16,21)(H,17,18,19,20) |
| InChIKey | PERIQWRVBKBSFM-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 124.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'} |
|---|