C22H19N3O5S — CID 168588627
methyl 4-[2-[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenoxy]ethoxy]benzoate (PubChem CID 168588627) has the molecular formula C22H19N3O5S and a molecular weight of 437.48 g/mol. Its IUPAC name is methyl 4-[2-[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenoxy]ethoxy]benzoate.
| Compound Name | methyl 4-[2-[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 168588627 |
| Molecular Formula | C22H19N3O5S |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | methyl 4-[2-[3-(5-cyano-2-methylsulfanyl-6-oxo-1H-pyrimidin-4-yl)phenoxy]ethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCOc2cccc(-c3nc(SC)[nH]c(=O)c3C#N)c2)cc1 |
| InChI | InChI=1S/C22H19N3O5S/c1-28-21(27)14-6-8-16(9-7-14)29-10-11-30-17-5-3-4-15(12-17)19-18(13-23)20(26)25-22(24-19)31-2/h3-9,12H,10-11H2,1-2H3,(H,24,25,26) |
| InChIKey | FQJGDWJDRDBMIN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 114.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_B(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|