C24H20N4O5 — CID 169395668
methyl 4-[3-[3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenoxy]propoxy]benzoate (PubChem CID 169395668) has the molecular formula C24H20N4O5 and a molecular weight of 444.45 g/mol. Its IUPAC name is methyl 4-[3-[3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenoxy]propoxy]benzoate.
| Compound Name | methyl 4-[3-[3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenoxy]propoxy]benzoate |
|---|---|
| PubChem CID | 169395668 |
| Molecular Formula | C24H20N4O5 |
| Molecular Weight | 444.45 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl 4-[3-[3-(2-amino-3,5-dicyano-6-oxo-1H-pyridin-4-yl)phenoxy]propoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCCCOc2cccc(-c3c(C#N)c(N)[nH]c(=O)c3C#N)c2)cc1 |
| InChI | InChI=1S/C24H20N4O5/c1-31-24(30)15-6-8-17(9-7-15)32-10-3-11-33-18-5-2-4-16(12-18)21-19(13-25)22(27)28-23(29)20(21)14-26/h2,4-9,12H,3,10-11H2,1H3,(H3,27,28,29) |
| InChIKey | PVZOWIVPQIZMKN-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 151.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.45 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|