C15H9N3O3S — CID 176980550
methyl 3-(3,5-dicyano-2-oxo-6-sulfanyl-1H-pyridin-4-yl)benzoate (PubChem CID 176980550) has the molecular formula C15H9N3O3S and a molecular weight of 311.32 g/mol. Its IUPAC name is methyl 3-(3,5-dicyano-2-oxo-6-sulfanyl-1H-pyridin-4-yl)benzoate.
| Compound Name | methyl 3-(3,5-dicyano-2-oxo-6-sulfanyl-1H-pyridin-4-yl)benzoate |
|---|---|
| PubChem CID | 176980550 |
| Molecular Formula | C15H9N3O3S |
| Molecular Weight | 311.32 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | methyl 3-(3,5-dicyano-2-oxo-6-sulfanyl-1H-pyridin-4-yl)benzoate |
| SMILES | COC(=O)c1cccc(-c2c(C#N)c(S)[nH]c(=O)c2C#N)c1 |
| InChI | InChI=1S/C15H9N3O3S/c1-21-15(20)9-4-2-3-8(5-9)12-10(6-16)13(19)18-14(22)11(12)7-17/h2-5H,1H3,(H2,18,19,22) |
| InChIKey | UFWLLOVNDOYPGN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.32 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|