C19H15N5O2 — CID 169398246
methyl 3-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate (PubChem CID 169398246) has the molecular formula C19H15N5O2 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 3-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate.
| Compound Name | methyl 3-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate |
|---|---|
| PubChem CID | 169398246 |
| Molecular Formula | C19H15N5O2 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | methyl 3-[3-(2,6-diamino-5-cyanopyrimidin-4-yl)phenyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cccc(-c3nc(N)nc(N)c3C#N)c2)c1 |
| InChI | InChI=1S/C19H15N5O2/c1-26-18(25)14-7-3-5-12(9-14)11-4-2-6-13(8-11)16-15(10-20)17(21)24-19(22)23-16/h2-9H,1H3,(H4,21,22,23,24) |
| InChIKey | SISMSSMZWWZSBS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |