C18H13N3O3 — CID 56752371
methyl 3-[2-amino-3-cyano-6-(furan-2-yl)-4-pyridinyl]benzoate (PubChem CID 56752371) has the molecular formula C18H13N3O3 and a molecular weight of 319.32 g/mol. Its IUPAC name is methyl 3-[2-amino-3-cyano-6-(furan-2-yl)-4-pyridinyl]benzoate.
| Compound Name | methyl 3-[2-amino-3-cyano-6-(furan-2-yl)-4-pyridinyl]benzoate |
|---|---|
| PubChem CID | 56752371 |
| Molecular Formula | C18H13N3O3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | methyl 3-[2-amino-3-cyano-6-(furan-2-yl)-4-pyridinyl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cc(-c3ccco3)nc(N)c2C#N)c1 |
| InChI | InChI=1S/C18H13N3O3/c1-23-18(22)12-5-2-4-11(8-12)13-9-15(16-6-3-7-24-16)21-17(20)14(13)10-19/h2-9H,1H3,(H2,20,21) |
| InChIKey | KDGZFZASIOHQLD-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 102.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |