C17H13N3O2 — CID 5153770
2-amino-4-(furan-2-yl)-6-(2-methoxyphenyl)pyridine-3-carbonitrile (PubChem CID 5153770) has the molecular formula C17H13N3O2 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-amino-4-(furan-2-yl)-6-(2-methoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(furan-2-yl)-6-(2-methoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5153770 |
| Molecular Formula | C17H13N3O2 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-amino-4-(furan-2-yl)-6-(2-methoxyphenyl)pyridine-3-carbonitrile |
| SMILES | COc1ccccc1-c1cc(-c2ccco2)c(C#N)c(N)n1 |
| InChI | InChI=1S/C17H13N3O2/c1-21-15-6-3-2-5-11(15)14-9-12(16-7-4-8-22-16)13(10-18)17(19)20-14/h2-9H,1H3,(H2,19,20) |
| InChIKey | XTAAUBQPKLVUCS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |