C20H13N3O — CID 166594868
2-amino-6-(furan-2-yl)-4-naphthalen-2-ylpyridine-3-carbonitrile (PubChem CID 166594868) has the molecular formula C20H13N3O and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-amino-6-(furan-2-yl)-4-naphthalen-2-ylpyridine-3-carbonitrile.
| Compound Name | 2-amino-6-(furan-2-yl)-4-naphthalen-2-ylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 166594868 |
| Molecular Formula | C20H13N3O |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 2-amino-6-(furan-2-yl)-4-naphthalen-2-ylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc3ccccc3c2)cc(-c2ccco2)nc1N |
| InChI | InChI=1S/C20H13N3O/c21-12-17-16(11-18(23-20(17)22)19-6-3-9-24-19)15-8-7-13-4-1-2-5-14(13)10-15/h1-11H,(H2,22,23) |
| InChIKey | LWAUPWLUZQTROY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |