C16H10FN3O — CID 10446308
2-amino-4-(4-fluorophenyl)-6-(furan-2-yl)pyridine-3-carbonitrile (PubChem CID 10446308) has the molecular formula C16H10FN3O and a molecular weight of 279.27 g/mol. Its IUPAC name is 2-amino-4-(4-fluorophenyl)-6-(furan-2-yl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(4-fluorophenyl)-6-(furan-2-yl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 10446308 |
| Molecular Formula | C16H10FN3O |
| Molecular Weight | 279.27 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | 2-amino-4-(4-fluorophenyl)-6-(furan-2-yl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccc(F)cc2)cc(-c2ccco2)nc1N |
| InChI | InChI=1S/C16H10FN3O/c17-11-5-3-10(4-6-11)12-8-14(15-2-1-7-21-15)20-16(19)13(12)9-18/h1-8H,(H2,19,20) |
| InChIKey | KYWCABSGOZQLPS-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.27 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |