C18H11F2N3 — CID 3355373
2-amino-4-(2-fluorophenyl)-6-(4-fluorophenyl)pyridine-3-carbonitrile (PubChem CID 3355373) has the molecular formula C18H11F2N3 and a molecular weight of 307.30 g/mol. Its IUPAC name is 2-amino-4-(2-fluorophenyl)-6-(4-fluorophenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(2-fluorophenyl)-6-(4-fluorophenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3355373 |
| Molecular Formula | C18H11F2N3 |
| Molecular Weight | 307.30 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 2-amino-4-(2-fluorophenyl)-6-(4-fluorophenyl)pyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2F)cc(-c2ccc(F)cc2)nc1N |
| InChI | InChI=1S/C18H11F2N3/c19-12-7-5-11(6-8-12)17-9-14(15(10-21)18(22)23-17)13-3-1-2-4-16(13)20/h1-9H,(H2,22,23) |
| InChIKey | VSGOYCPCKORCDR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.30 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |