C25H19N3O — CID 5231002
2-amino-4-(2-methoxyphenyl)-6-(4-phenylphenyl)pyridine-3-carbonitrile (PubChem CID 5231002) has the molecular formula C25H19N3O and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-amino-4-(2-methoxyphenyl)-6-(4-phenylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-(2-methoxyphenyl)-6-(4-phenylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 5231002 |
| Molecular Formula | C25H19N3O |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-amino-4-(2-methoxyphenyl)-6-(4-phenylphenyl)pyridine-3-carbonitrile |
| SMILES | COc1ccccc1-c1cc(-c2ccc(-c3ccccc3)cc2)nc(N)c1C#N |
| InChI | InChI=1S/C25H19N3O/c1-29-24-10-6-5-9-20(24)21-15-23(28-25(27)22(21)16-26)19-13-11-18(12-14-19)17-7-3-2-4-8-17/h2-15H,1H3,(H2,27,28) |
| InChIKey | WLPNDSGFYUHZQH-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |