C26H22N4 — CID 4659292
2-amino-4-[4-(dimethylamino)phenyl]-6-(4-phenylphenyl)pyridine-3-carbonitrile (PubChem CID 4659292) has the molecular formula C26H22N4 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-amino-4-[4-(dimethylamino)phenyl]-6-(4-phenylphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-amino-4-[4-(dimethylamino)phenyl]-6-(4-phenylphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4659292 |
| Molecular Formula | C26H22N4 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | 2-amino-4-[4-(dimethylamino)phenyl]-6-(4-phenylphenyl)pyridine-3-carbonitrile |
| SMILES | CN(C)c1ccc(-c2cc(-c3ccc(-c4ccccc4)cc3)nc(N)c2C#N)cc1 |
| InChI | InChI=1S/C26H22N4/c1-30(2)22-14-12-20(13-15-22)23-16-25(29-26(28)24(23)17-27)21-10-8-19(9-11-21)18-6-4-3-5-7-18/h3-16H,1-2H3,(H2,28,29) |
| InChIKey | GEIIDYHIXUCHOL-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 65.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |