C19H14N2 — CID 4135564
2-methyl-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 4135564) has the molecular formula C19H14N2 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-methyl-4,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 2-methyl-4,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 4135564 |
| Molecular Formula | C19H14N2 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-methyl-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | Cc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C19H14N2/c1-14-18(13-20)17(15-8-4-2-5-9-15)12-19(21-14)16-10-6-3-7-11-16/h2-12H,1H3 |
| InChIKey | HYIMBGTWIHWDII-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |