C20H16N2 — CID 102404081
2-ethyl-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 102404081) has the molecular formula C20H16N2 and a molecular weight of 284.36 g/mol. Its IUPAC name is 2-ethyl-4,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 2-ethyl-4,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 102404081 |
| Molecular Formula | C20H16N2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-ethyl-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | CCc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C20H16N2/c1-2-19-18(14-21)17(15-9-5-3-6-10-15)13-20(22-19)16-11-7-4-8-12-16/h3-13H,2H2,1H3 |
| InChIKey | MNEUATDKYWFWBC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |