C22H21N3 — CID 44522390
2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 44522390) has the molecular formula C22H21N3 and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 44522390 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | CCN(CC)c1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C22H21N3/c1-3-25(4-2)22-20(16-23)19(17-11-7-5-8-12-17)15-21(24-22)18-13-9-6-10-14-18/h5-15H,3-4H2,1-2H3 |
| InChIKey | HADKPWNXMPVUTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |