About 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile
2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 44522390) has the molecular formula C22H21N3
and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile |
| PubChem CID | 44522390 |
| Molecular Formula | C22H21N3 |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | CCN(CC)c1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C22H21N3/c1-3-25(4-2)22-20(16-23)19(17-11-7-5-8-12-17)15-21(24-22)18-13-9-6-10-14-18/h5-15H,3-4H2,1-2H3 |
| InChIKey | HADKPWNXMPVUTG-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile?
The IUPAC name of 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile (CID 44522390) is 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile.
What is the SMILES notation for 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile?
The canonical SMILES for 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile is CCN(CC)c1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N.
What is the InChIKey of 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile?
The InChIKey is HADKPWNXMPVUTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N3/c1-3-25(4-2)22-20(16-23)19(17-11-7-5-8-12-17)15-21(24-22)18-13-9-6-10-14-18/h5-15H,3-4H2,1-2H3.
What are the key properties of 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile?
2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile has a molecular weight of 327.43 g/mol, XLogP of 5.13, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)-4,6-diphenylpyridine-3-carbonitrile is sourced from PubChem (CID 44522390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).