C25H18N2 — CID 12575122
6-(4-methylphenyl)-2,4-diphenylpyridine-3-carbonitrile (PubChem CID 12575122) has the molecular formula C25H18N2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 6-(4-methylphenyl)-2,4-diphenylpyridine-3-carbonitrile.
| Compound Name | 6-(4-methylphenyl)-2,4-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12575122 |
| Molecular Formula | C25H18N2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 6-(4-methylphenyl)-2,4-diphenylpyridine-3-carbonitrile |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)c(C#N)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H18N2/c1-18-12-14-20(15-13-18)24-16-22(19-8-4-2-5-9-19)23(17-26)25(27-24)21-10-6-3-7-11-21/h2-16H,1H3 |
| InChIKey | BMHFGKUPEDJZEB-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |