C22H18N2O2S — CID 53270290
3-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanoic acid (PubChem CID 53270290) has the molecular formula C22H18N2O2S and a molecular weight of 374.47 g/mol. Its IUPAC name is 3-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanoic acid.
| Compound Name | 3-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 53270290 |
| Molecular Formula | C22H18N2O2S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 3-[[3-cyano-4-(4-methylphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanoic acid |
| SMILES | Cc1ccc(-c2cc(-c3ccccc3)nc(SCCC(=O)O)c2C#N)cc1 |
| InChI | InChI=1S/C22H18N2O2S/c1-15-7-9-16(10-8-15)18-13-20(17-5-3-2-4-6-17)24-22(19(18)14-23)27-12-11-21(25)26/h2-10,13H,11-12H2,1H3,(H,25,26) |
| InChIKey | MCMJELLHYCJCBS-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 73.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |