C22H20N2O2S2 — CID 3380391
2-(2-ethylsulfonylethylsulfanyl)-4,6-diphenylpyridine-3-carbonitrile (PubChem CID 3380391) has the molecular formula C22H20N2O2S2 and a molecular weight of 408.55 g/mol. Its IUPAC name is 2-(2-ethylsulfonylethylsulfanyl)-4,6-diphenylpyridine-3-carbonitrile.
| Compound Name | 2-(2-ethylsulfonylethylsulfanyl)-4,6-diphenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3380391 |
| Molecular Formula | C22H20N2O2S2 |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-(2-ethylsulfonylethylsulfanyl)-4,6-diphenylpyridine-3-carbonitrile |
| SMILES | CCS(=O)(=O)CCSc1nc(-c2ccccc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C22H20N2O2S2/c1-2-28(25,26)14-13-27-22-20(16-23)19(17-9-5-3-6-10-17)15-21(24-22)18-11-7-4-8-12-18/h3-12,15H,2,13-14H2,1H3 |
| InChIKey | NIPRYOZJQUDXFI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |