About 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile
6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile (PubChem CID 3613815) has the molecular formula C24H21BrN2OS
and a molecular weight of 465.42 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
| PubChem CID | 3613815 |
| Molecular Formula | C24H21BrN2OS |
| Molecular Weight | 465.42 g/mol |
| Exact Mass | 464.06 |
| IUPAC Name | 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
| SMILES | CC(C)(C)C(=O)CSc1nc(-c2ccc(Br)cc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C24H21BrN2OS/c1-24(2,3)22(28)15-29-23-20(14-26)19(16-7-5-4-6-8-16)13-21(27-23)17-9-11-18(25)12-10-17/h4-13H,15H2,1-3H3 |
| InChIKey | PNHZEWGVVCJONU-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.42 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile?
The IUPAC name of 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile (CID 3613815) is 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile.
What is the SMILES notation for 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile?
The canonical SMILES for 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile is CC(C)(C)C(=O)CSc1nc(-c2ccc(Br)cc2)cc(-c2ccccc2)c1C#N.
What is the InChIKey of 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile?
The InChIKey is PNHZEWGVVCJONU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21BrN2OS/c1-24(2,3)22(28)15-29-23-20(14-26)19(16-7-5-4-6-8-16)13-21(27-23)17-9-11-18(25)12-10-17/h4-13H,15H2,1-3H3.
What are the key properties of 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile?
6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile has a molecular weight of 465.42 g/mol, XLogP of 6.76, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(4-bromophenyl)-2-(3,3-dimethyl-2-oxobutyl)sulfanyl-4-phenylpyridine-3-carbonitrile is sourced from PubChem (CID 3613815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).