C25H25BrN2OS2 — CID 3348807
6-(4-bromophenyl)-2-(3-butylsulfanyl-2-hydroxypropyl)sulfanyl-4-phenylpyridine-3-carbonitrile (PubChem CID 3348807) has the molecular formula C25H25BrN2OS2 and a molecular weight of 513.53 g/mol. Its IUPAC name is 6-(4-bromophenyl)-2-(3-butylsulfanyl-2-hydroxypropyl)sulfanyl-4-phenylpyridine-3-carbonitrile.
| Compound Name | 6-(4-bromophenyl)-2-(3-butylsulfanyl-2-hydroxypropyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3348807 |
| Molecular Formula | C25H25BrN2OS2 |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 512.06 |
| IUPAC Name | 6-(4-bromophenyl)-2-(3-butylsulfanyl-2-hydroxypropyl)sulfanyl-4-phenylpyridine-3-carbonitrile |
| SMILES | CCCCSCC(O)CSc1nc(-c2ccc(Br)cc2)cc(-c2ccccc2)c1C#N |
| InChI | InChI=1S/C25H25BrN2OS2/c1-2-3-13-30-16-21(29)17-31-25-23(15-27)22(18-7-5-4-6-8-18)14-24(28-25)19-9-11-20(26)12-10-19/h4-12,14,21,29H,2-3,13,16-17H2,1H3 |
| InChIKey | RDCHCRLOFJIURF-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|