C25H17BrN2S — CID 3125938
2-benzylsulfanyl-6-(4-bromophenyl)-4-phenylpyridine-3-carbonitrile (PubChem CID 3125938) has the molecular formula C25H17BrN2S and a molecular weight of 457.40 g/mol. Its IUPAC name is 2-benzylsulfanyl-6-(4-bromophenyl)-4-phenylpyridine-3-carbonitrile.
| Compound Name | 2-benzylsulfanyl-6-(4-bromophenyl)-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3125938 |
| Molecular Formula | C25H17BrN2S |
| Molecular Weight | 457.40 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | 2-benzylsulfanyl-6-(4-bromophenyl)-4-phenylpyridine-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccc(Br)cc2)nc1SCc1ccccc1 |
| InChI | InChI=1S/C25H17BrN2S/c26-21-13-11-20(12-14-21)24-15-22(19-9-5-2-6-10-19)23(16-27)25(28-24)29-17-18-7-3-1-4-8-18/h1-15H,17H2 |
| InChIKey | HGGBSFJRIZCAAJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.40 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |