C27H22N2OS2 — CID 3330687
2-(benzylsulfanylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile (PubChem CID 3330687) has the molecular formula C27H22N2OS2 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-(benzylsulfanylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile.
| Compound Name | 2-(benzylsulfanylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3330687 |
| Molecular Formula | C27H22N2OS2 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | 2-(benzylsulfanylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(C#N)c(SCSCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C27H22N2OS2/c1-30-23-14-12-22(13-15-23)26-16-24(21-10-6-3-7-11-21)25(17-28)27(29-26)32-19-31-18-20-8-4-2-5-9-20/h2-16H,18-19H2,1H3 |
| InChIKey | SCQWGAYWTZTUDH-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|