C26H20N2O2 — CID 12575125
4,6-bis(4-methoxyphenyl)-2-phenylpyridine-3-carbonitrile (PubChem CID 12575125) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 4,6-bis(4-methoxyphenyl)-2-phenylpyridine-3-carbonitrile.
| Compound Name | 4,6-bis(4-methoxyphenyl)-2-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 12575125 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 4,6-bis(4-methoxyphenyl)-2-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c(C#N)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C26H20N2O2/c1-29-21-12-8-18(9-13-21)23-16-25(19-10-14-22(30-2)15-11-19)28-26(24(23)17-27)20-6-4-3-5-7-20/h3-16H,1-2H3 |
| InChIKey | GTCGIYHEYXJBNS-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |