C26H19FN2OS — CID 3329563
2-[(4-fluorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-phenylpyridine-3-carbonitrile (PubChem CID 3329563) has the molecular formula C26H19FN2OS and a molecular weight of 426.52 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-phenylpyridine-3-carbonitrile.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3329563 |
| Molecular Formula | C26H19FN2OS |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-4-(4-methoxyphenyl)-6-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SCc3ccc(F)cc3)c2C#N)cc1 |
| InChI | InChI=1S/C26H19FN2OS/c1-30-22-13-9-19(10-14-22)23-15-25(20-5-3-2-4-6-20)29-26(24(23)16-28)31-17-18-7-11-21(27)12-8-18/h2-15H,17H2,1H3 |
| InChIKey | TWNWFMSUSCLWLP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|