C31H22N2O4S — CID 146681689
2-[(3-acetyl-2-oxochromen-6-yl)methylsulfanyl]-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile (PubChem CID 146681689) has the molecular formula C31H22N2O4S and a molecular weight of 518.59 g/mol. Its IUPAC name is 2-[(3-acetyl-2-oxochromen-6-yl)methylsulfanyl]-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile.
| Compound Name | 2-[(3-acetyl-2-oxochromen-6-yl)methylsulfanyl]-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 146681689 |
| Molecular Formula | C31H22N2O4S |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.13 |
| IUPAC Name | 2-[(3-acetyl-2-oxochromen-6-yl)methylsulfanyl]-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(C#N)c(SCc3ccc4oc(=O)c(C(C)=O)cc4c3)n2)cc1 |
| InChI | InChI=1S/C31H22N2O4S/c1-19(34)25-15-23-14-20(8-13-29(23)37-31(25)35)18-38-30-27(17-32)26(21-6-4-3-5-7-21)16-28(33-30)22-9-11-24(36-2)12-10-22/h3-16H,18H2,1-2H3 |
| InChIKey | ZXDQNRSQHGPIHZ-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 93.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|