C28H19F4N3O2S — CID 23775235
3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 23775235) has the molecular formula C28H19F4N3O2S and a molecular weight of 537.54 g/mol. Its IUPAC name is 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 23775235 |
| Molecular Formula | C28H19F4N3O2S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.11 |
| IUPAC Name | 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SCCC(=O)Nc3c(F)c(F)cc(F)c3F)c2C#N)cc1 |
| InChI | InChI=1S/C28H19F4N3O2S/c1-37-18-9-7-16(8-10-18)19-13-23(17-5-3-2-4-6-17)34-28(20(19)15-33)38-12-11-24(36)35-27-25(31)21(29)14-22(30)26(27)32/h2-10,13-14H,11-12H2,1H3,(H,35,36) |
| InChIKey | KAMRJVIFKHHVAZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|