C28H21Cl2N3O2S — CID 23746017
3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,5-dichlorophenyl)propanamide (PubChem CID 23746017) has the molecular formula C28H21Cl2N3O2S and a molecular weight of 534.47 g/mol. Its IUPAC name is 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 23746017 |
| Molecular Formula | C28H21Cl2N3O2S |
| Molecular Weight | 534.47 g/mol |
| Exact Mass | 533.07 |
| IUPAC Name | 3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]-N-(2,5-dichlorophenyl)propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SCCC(=O)Nc3cc(Cl)ccc3Cl)c2C#N)cc1 |
| InChI | InChI=1S/C28H21Cl2N3O2S/c1-35-21-10-7-18(8-11-21)22-16-25(19-5-3-2-4-6-19)33-28(23(22)17-31)36-14-13-27(34)32-26-15-20(29)9-12-24(26)30/h2-12,15-16H,13-14H2,1H3,(H,32,34) |
| InChIKey | ALGZJSNWMBIEJC-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.47 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|