C30H26ClN3O4S — CID 23917269
N-(5-chloro-2,4-dimethoxyphenyl)-3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanamide (PubChem CID 23917269) has the molecular formula C30H26ClN3O4S and a molecular weight of 560.08 g/mol. Its IUPAC name is N-(5-chloro-2,4-dimethoxyphenyl)-3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanamide.
| Compound Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanamide |
|---|---|
| PubChem CID | 23917269 |
| Molecular Formula | C30H26ClN3O4S |
| Molecular Weight | 560.08 g/mol |
| Exact Mass | 559.13 |
| IUPAC Name | N-(5-chloro-2,4-dimethoxyphenyl)-3-[[3-cyano-4-(4-methoxyphenyl)-6-phenyl-2-pyridinyl]sulfanyl]propanamide |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)nc(SCCC(=O)Nc3cc(Cl)c(OC)cc3OC)c2C#N)cc1 |
| InChI | InChI=1S/C30H26ClN3O4S/c1-36-21-11-9-19(10-12-21)22-15-25(20-7-5-4-6-8-20)34-30(23(22)18-32)39-14-13-29(35)33-26-16-24(31)27(37-2)17-28(26)38-3/h4-12,15-17H,13-14H2,1-3H3,(H,33,35) |
| InChIKey | GYKWSAWEHOLEGF-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.08 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_pyr_A(3)', 'substructure': 'N/A'} |
|---|