C26H26N2OS — CID 3131140
2-(cyclohexylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile (PubChem CID 3131140) has the molecular formula C26H26N2OS and a molecular weight of 414.57 g/mol. Its IUPAC name is 2-(cyclohexylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile.
| Compound Name | 2-(cyclohexylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
|---|---|
| PubChem CID | 3131140 |
| Molecular Formula | C26H26N2OS |
| Molecular Weight | 414.57 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | 2-(cyclohexylmethylsulfanyl)-6-(4-methoxyphenyl)-4-phenylpyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2cc(-c3ccccc3)c(C#N)c(SCC3CCCCC3)n2)cc1 |
| InChI | InChI=1S/C26H26N2OS/c1-29-22-14-12-21(13-15-22)25-16-23(20-10-6-3-7-11-20)24(17-27)26(28-25)30-18-19-8-4-2-5-9-19/h3,6-7,10-16,19H,2,4-5,8-9,18H2,1H3 |
| InChIKey | XQBIDRFAIUYQIK-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |