C20H15FN2OS — CID 25249091
2-[(4-fluorophenyl)methylsulfanyl]-6-(4-methoxyphenyl)pyridine-3-carbonitrile (PubChem CID 25249091) has the molecular formula C20H15FN2OS and a molecular weight of 350.42 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-6-(4-methoxyphenyl)pyridine-3-carbonitrile.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-6-(4-methoxyphenyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 25249091 |
| Molecular Formula | C20H15FN2OS |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-6-(4-methoxyphenyl)pyridine-3-carbonitrile |
| SMILES | COc1ccc(-c2ccc(C#N)c(SCc3ccc(F)cc3)n2)cc1 |
| InChI | InChI=1S/C20H15FN2OS/c1-24-18-9-4-15(5-10-18)19-11-6-16(12-22)20(23-19)25-13-14-2-7-17(21)8-3-14/h2-11H,13H2,1H3 |
| InChIKey | OOQOHELNHVZTBI-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |