C21H14F2N2O3S — CID 125117785
(2,4-difluorophenyl) 2-[[3-cyano-6-(3-methoxyphenyl)-2-pyridinyl]sulfanyl]acetate (PubChem CID 125117785) has the molecular formula C21H14F2N2O3S and a molecular weight of 412.42 g/mol. Its IUPAC name is (2,4-difluorophenyl) 2-[[3-cyano-6-(3-methoxyphenyl)-2-pyridinyl]sulfanyl]acetate.
| Compound Name | (2,4-difluorophenyl) 2-[[3-cyano-6-(3-methoxyphenyl)-2-pyridinyl]sulfanyl]acetate |
|---|---|
| PubChem CID | 125117785 |
| Molecular Formula | C21H14F2N2O3S |
| Molecular Weight | 412.42 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | (2,4-difluorophenyl) 2-[[3-cyano-6-(3-methoxyphenyl)-2-pyridinyl]sulfanyl]acetate |
| SMILES | COc1cccc(-c2ccc(C#N)c(SCC(=O)Oc3ccc(F)cc3F)n2)c1 |
| InChI | InChI=1S/C21H14F2N2O3S/c1-27-16-4-2-3-13(9-16)18-7-5-14(11-24)21(25-18)29-12-20(26)28-19-8-6-15(22)10-17(19)23/h2-10H,12H2,1H3 |
| InChIKey | QLGRYWAHYRHXCR-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 72.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|