C21H17F2N3O3 — CID 90577593
N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 90577593) has the molecular formula C21H17F2N3O3 and a molecular weight of 397.38 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90577593 |
| Molecular Formula | C21H17F2N3O3 |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | N-[4-(2,4-difluorophenoxy)but-2-ynyl]-3-(3-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1cccc(-c2cc(C(=O)NCC#CCOc3ccc(F)cc3F)[nH]n2)c1 |
| InChI | InChI=1S/C21H17F2N3O3/c1-28-16-6-4-5-14(11-16)18-13-19(26-25-18)21(27)24-9-2-3-10-29-20-8-7-15(22)12-17(20)23/h4-8,11-13H,9-10H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | YDVQDJDMGRDVJO-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|