C20H15BrFN3O2 — CID 90576385
N-[4-(3-bromophenoxy)but-2-ynyl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 90576385) has the molecular formula C20H15BrFN3O2 and a molecular weight of 428.26 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90576385 |
| Molecular Formula | C20H15BrFN3O2 |
| Molecular Weight | 428.26 g/mol |
| Exact Mass | 427.03 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]-3-(4-fluorophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc(Br)c1)c1cc(-c2ccc(F)cc2)n[nH]1 |
| InChI | InChI=1S/C20H15BrFN3O2/c21-15-4-3-5-17(12-15)27-11-2-1-10-23-20(26)19-13-18(24-25-19)14-6-8-16(22)9-7-14/h3-9,12-13H,10-11H2,(H,23,26)(H,24,25) |
| InChIKey | HCLULJLCYGEKKP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.26 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|