C21H16BrNO2 — CID 90576498
N-[4-(3-bromophenoxy)but-2-ynyl]naphthalene-2-carboxamide (PubChem CID 90576498) has the molecular formula C21H16BrNO2 and a molecular weight of 394.27 g/mol. Its IUPAC name is N-[4-(3-bromophenoxy)but-2-ynyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(3-bromophenoxy)but-2-ynyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90576498 |
| Molecular Formula | C21H16BrNO2 |
| Molecular Weight | 394.27 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | N-[4-(3-bromophenoxy)but-2-ynyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc(Br)c1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C21H16BrNO2/c22-19-8-5-9-20(15-19)25-13-4-3-12-23-21(24)18-11-10-16-6-1-2-7-17(16)14-18/h1-2,5-11,14-15H,12-13H2,(H,23,24) |
| InChIKey | PVYJRMZWLAYGEW-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.27 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|