C22H18N2O3 — CID 90580490
N-[4-(2-carbamoylphenoxy)but-2-ynyl]naphthalene-2-carboxamide (PubChem CID 90580490) has the molecular formula C22H18N2O3 and a molecular weight of 358.40 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)but-2-ynyl]naphthalene-2-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 90580490 |
| Molecular Formula | C22H18N2O3 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]naphthalene-2-carboxamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H18N2O3/c23-21(25)19-9-3-4-10-20(19)27-14-6-5-13-24-22(26)18-12-11-16-7-1-2-8-17(16)15-18/h1-4,7-12,15H,13-14H2,(H2,23,25)(H,24,26) |
| InChIKey | JDSPGCTVHLCUCZ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|