C18H16N2O3 — CID 90580452
2-(4-benzamidobut-2-ynoxy)benzamide (PubChem CID 90580452) has the molecular formula C18H16N2O3 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-(4-benzamidobut-2-ynoxy)benzamide.
| Compound Name | 2-(4-benzamidobut-2-ynoxy)benzamide |
|---|---|
| PubChem CID | 90580452 |
| Molecular Formula | C18H16N2O3 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | 2-(4-benzamidobut-2-ynoxy)benzamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N2O3/c19-17(21)15-10-4-5-11-16(15)23-13-7-6-12-20-18(22)14-8-2-1-3-9-14/h1-5,8-11H,12-13H2,(H2,19,21)(H,20,22) |
| InChIKey | ARGVLHQJNJYYPO-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|