About 2-but-2-ynoxybenzamide
2-but-2-ynoxybenzamide (PubChem CID 177469094) has the molecular formula C11H11NO2
and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-but-2-ynoxybenzamide.
Molecular Properties
| Compound Name | 2-but-2-ynoxybenzamide |
| PubChem CID | 177469094 |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | 2-but-2-ynoxybenzamide |
| SMILES | CC#CCOc1ccccc1C(N)=O |
| InChI | InChI=1S/C11H11NO2/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-7H,8H2,1H3,(H2,12,13) |
| InChIKey | ZXOXTEWNROJQIC-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-but-2-ynoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-but-2-ynoxybenzamide?
The IUPAC name of 2-but-2-ynoxybenzamide (CID 177469094) is 2-but-2-ynoxybenzamide.
What is the SMILES notation for 2-but-2-ynoxybenzamide?
The canonical SMILES for 2-but-2-ynoxybenzamide is CC#CCOc1ccccc1C(N)=O.
What is the InChIKey of 2-but-2-ynoxybenzamide?
The InChIKey is ZXOXTEWNROJQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2/c1-2-3-8-14-10-7-5-4-6-9(10)11(12)13/h4-7H,8H2,1H3,(H2,12,13).
What are the key properties of 2-but-2-ynoxybenzamide?
2-but-2-ynoxybenzamide has a molecular weight of 189.21 g/mol, XLogP of 1.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-but-2-ynoxybenzamide is sourced from PubChem (CID 177469094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).