C17H16N2O3S — CID 71803258
2-[4-[(2-thiophen-2-ylacetyl)amino]but-2-ynoxy]benzamide (PubChem CID 71803258) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 2-[4-[(2-thiophen-2-ylacetyl)amino]but-2-ynoxy]benzamide.
| Compound Name | 2-[4-[(2-thiophen-2-ylacetyl)amino]but-2-ynoxy]benzamide |
|---|---|
| PubChem CID | 71803258 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2-[4-[(2-thiophen-2-ylacetyl)amino]but-2-ynoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)Cc1cccs1 |
| InChI | InChI=1S/C17H16N2O3S/c18-17(21)14-7-1-2-8-15(14)22-10-4-3-9-19-16(20)12-13-6-5-11-23-13/h1-2,5-8,11H,9-10,12H2,(H2,18,21)(H,19,20) |
| InChIKey | VYCHAJHIGGKMOQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|