C16H16N4O3 — CID 90580568
2-[4-[(2-pyrazol-1-ylacetyl)amino]but-2-ynoxy]benzamide (PubChem CID 90580568) has the molecular formula C16H16N4O3 and a molecular weight of 312.33 g/mol. Its IUPAC name is 2-[4-[(2-pyrazol-1-ylacetyl)amino]but-2-ynoxy]benzamide.
| Compound Name | 2-[4-[(2-pyrazol-1-ylacetyl)amino]but-2-ynoxy]benzamide |
|---|---|
| PubChem CID | 90580568 |
| Molecular Formula | C16H16N4O3 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[4-[(2-pyrazol-1-ylacetyl)amino]but-2-ynoxy]benzamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)Cn1cccn1 |
| InChI | InChI=1S/C16H16N4O3/c17-16(22)13-6-1-2-7-14(13)23-11-4-3-8-18-15(21)12-20-10-5-9-19-20/h1-2,5-7,9-10H,8,11-12H2,(H2,17,22)(H,18,21) |
| InChIKey | MVGGGHUYKXMKFV-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|