C20H20N2O5 — CID 90580499
2-[4-[[2-(3-methoxyphenoxy)acetyl]amino]but-2-ynoxy]benzamide (PubChem CID 90580499) has the molecular formula C20H20N2O5 and a molecular weight of 368.39 g/mol. Its IUPAC name is 2-[4-[[2-(3-methoxyphenoxy)acetyl]amino]but-2-ynoxy]benzamide.
| Compound Name | 2-[4-[[2-(3-methoxyphenoxy)acetyl]amino]but-2-ynoxy]benzamide |
|---|---|
| PubChem CID | 90580499 |
| Molecular Formula | C20H20N2O5 |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | 2-[4-[[2-(3-methoxyphenoxy)acetyl]amino]but-2-ynoxy]benzamide |
| SMILES | COc1cccc(OCC(=O)NCC#CCOc2ccccc2C(N)=O)c1 |
| InChI | InChI=1S/C20H20N2O5/c1-25-15-7-6-8-16(13-15)27-14-19(23)22-11-4-5-12-26-18-10-3-2-9-17(18)20(21)24/h2-3,6-10,13H,11-12,14H2,1H3,(H2,21,24)(H,22,23) |
| InChIKey | DLJOSVFRPAHUII-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|