C22H20N4O4 — CID 90580562
N-[4-(2-carbamoylphenoxy)but-2-ynyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide (PubChem CID 90580562) has the molecular formula C22H20N4O4 and a molecular weight of 404.43 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)but-2-ynyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 90580562 |
| Molecular Formula | C22H20N4O4 |
| Molecular Weight | 404.43 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-3-(2-methoxyphenyl)-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccccc1-c1cc(C(=O)NCC#CCOc2ccccc2C(N)=O)[nH]n1 |
| InChI | InChI=1S/C22H20N4O4/c1-29-19-10-4-2-8-15(19)17-14-18(26-25-17)22(28)24-12-6-7-13-30-20-11-5-3-9-16(20)21(23)27/h2-5,8-11,14H,12-13H2,1H3,(H2,23,27)(H,24,28)(H,25,26) |
| InChIKey | MJERZVLWECKCCC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.43 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|