C19H16N4O4 — CID 71803213
N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide (PubChem CID 71803213) has the molecular formula C19H16N4O4 and a molecular weight of 364.36 g/mol. Its IUPAC name is N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 71803213 |
| Molecular Formula | C19H16N4O4 |
| Molecular Weight | 364.36 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | N-[4-(2-carbamoylphenoxy)but-2-ynyl]-5-(furan-2-yl)-1H-pyrazole-3-carboxamide |
| SMILES | NC(=O)c1ccccc1OCC#CCNC(=O)c1cc(-c2ccco2)[nH]n1 |
| InChI | InChI=1S/C19H16N4O4/c20-18(24)13-6-1-2-7-16(13)26-10-4-3-9-21-19(25)15-12-14(22-23-15)17-8-5-11-27-17/h1-2,5-8,11-12H,9-10H2,(H2,20,24)(H,21,25)(H,22,23) |
| InChIKey | DNCGPHJGWLZFMN-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.36 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|