C22H16N2O4 — CID 90577990
5-(furan-2-yl)-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide (PubChem CID 90577990) has the molecular formula C22H16N2O4 and a molecular weight of 372.38 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 90577990 |
| Molecular Formula | C22H16N2O4 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 5-(furan-2-yl)-N-(4-naphthalen-1-yloxybut-2-ynyl)-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCC#CCOc1cccc2ccccc12)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C22H16N2O4/c25-22(18-15-21(28-24-18)20-11-6-14-27-20)23-12-3-4-13-26-19-10-5-8-16-7-1-2-9-17(16)19/h1-2,5-11,14-15H,12-13H2,(H,23,25) |
| InChIKey | GXHXIJBHLLLJHZ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|