C11H12N2O4 — CID 15995731
5-(furan-2-yl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide (PubChem CID 15995731) has the molecular formula C11H12N2O4 and a molecular weight of 236.23 g/mol. Its IUPAC name is 5-(furan-2-yl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-(furan-2-yl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 15995731 |
| Molecular Formula | C11H12N2O4 |
| Molecular Weight | 236.23 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 5-(furan-2-yl)-N-(2-methoxyethyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C11H12N2O4/c1-15-6-4-12-11(14)8-7-10(17-13-8)9-3-2-5-16-9/h2-3,5,7H,4,6H2,1H3,(H,12,14) |
| InChIKey | ZDLZRZRLXPCKIW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 77.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|