C12H12N2O5 — CID 47257374
ethyl 2-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]acetate (PubChem CID 47257374) has the molecular formula C12H12N2O5 and a molecular weight of 264.24 g/mol. Its IUPAC name is ethyl 2-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 47257374 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | ethyl 2-[[5-(furan-2-yl)-1,2-oxazole-3-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)c1cc(-c2ccco2)on1 |
| InChI | InChI=1S/C12H12N2O5/c1-2-17-11(15)7-13-12(16)8-6-10(19-14-8)9-4-3-5-18-9/h3-6H,2,7H2,1H3,(H,13,16) |
| InChIKey | YNEFRVQFOVUDBT-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |