C12H14N4O3 — CID 11737091
2-amino-6-(furan-2-yl)-N-(2-methoxyethyl)pyrimidine-4-carboxamide (PubChem CID 11737091) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 2-amino-6-(furan-2-yl)-N-(2-methoxyethyl)pyrimidine-4-carboxamide.
| Compound Name | 2-amino-6-(furan-2-yl)-N-(2-methoxyethyl)pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 11737091 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-amino-6-(furan-2-yl)-N-(2-methoxyethyl)pyrimidine-4-carboxamide |
| SMILES | COCCNC(=O)c1cc(-c2ccco2)nc(N)n1 |
| InChI | InChI=1S/C12H14N4O3/c1-18-6-4-14-11(17)9-7-8(15-12(13)16-9)10-3-2-5-19-10/h2-3,5,7H,4,6H2,1H3,(H,14,17)(H2,13,15,16) |
| InChIKey | QJOCSUQRXLMFAT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|