C14H15NO3 — CID 168525529
4-(furan-2-yl)-N-(2-methoxyethyl)benzamide (PubChem CID 168525529) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 4-(furan-2-yl)-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-(furan-2-yl)-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 168525529 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 4-(furan-2-yl)-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(-c2ccco2)cc1 |
| InChI | InChI=1S/C14H15NO3/c1-17-10-8-15-14(16)12-6-4-11(5-7-12)13-3-2-9-18-13/h2-7,9H,8,10H2,1H3,(H,15,16) |
| InChIKey | RNCRVQFWDLJVNW-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|